4-MDMC
2-(Dimethylamino)-1-(4-methylphenyl)propan-1-one
 8512  C12H17NO  191.269
 InChI=1S/C12H17NO/c1-9-5-7-11(8-6-9)12(14)10(2)13(3)4/h5-8,10H,1-4H3
 FXLSIGLYVVJURY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(C(=O)c1ccc(cc1)C)C)C