4-MPC
1-(4-Methylphenyl)-2-(propylamino)propan-1-one
 8510  C13H19NO  205.296
 InChI=1S/C13H19NO/c1-4-9-14-11(3)13(15)12-7-5-10(2)6-8-12/h5-8,11,14H,4,9H2,1-3H3
 HALBJKCZJSCGGE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC(C(=O)c1ccc(cc1)C)C