3-EEC
2-(Ethylamino)-1-(3-ethylphenyl)propan-1-one
 8508 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-4-11-7-6-8-12(9-11)13(15)10(3)14-5-2/h6-10,14H,4-5H2,1-3H3
 ZGWFZYCOHXHOHU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(=O)c1cccc(c1)CC)C