3-EMC
1-(3-Ethylphenyl)-2-(methylamino)propan-1-one
 8507  C12H17NO  191.269
 InChI=1S/C12H17NO/c1-4-10-6-5-7-11(8-10)12(14)9(2)13-3/h5-9,13H,4H2,1-3H3
 XKZMMQQSZJUMDL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1cccc(c1)CC)C