2-EEC
2-(Ethylamino)-1-(2-ethylphenyl)propan-1-one
 8506  C13H19NO  205.296
 InChI=1S/C13H19NO/c1-4-11-8-6-7-9-12(11)13(15)10(3)14-5-2/h6-10,14H,4-5H2,1-3H3
 YHAYVXPZBPEILT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(=O)c1ccccc1CC)C