α-CP-2C-E
1-[(4-Ethyl-2,5-dimethoxyphenyl)methyl]cyclopropan-1-amine
 8192 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-4-10-7-13(17-3)11(8-12(10)16-2)9-14(15)5-6-14/h7-8H,4-6,9,15H2,1-3H3
 VEILHGCZMSZLNO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC)c(cc1CC1(N)CC1)OC