4-cPeO-3,5-DMPEA
2-[4-(Cyclopentyloxy)-3,5-dimethoxyphenyl]ethan-1-amine
 8191  C15H23NO3  265.348
 InChI=1S/C15H23NO3/c1-17-13-9-11(7-8-16)10-14(18-2)15(13)19-12-5-3-4-6-12/h9-10,12H,3-8,16H2,1-2H3
 PIKKKIOLGUYFGL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC1CCCC1