SGT-10
1-(Cyclohexylmethyl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-1H-indole-3-carboxamide
 8153 C25H28N2O2 388.502
 Cannabinoid
 InChI=1S/C25H28N2O2/c28-23-14-18-10-4-5-11-19(18)24(23)26-25(29)21-16-27(15-17-8-2-1-3-9-17)22-13-7-6-12-20(21)22/h4-7,10-13,16-17,23-24,28H,1-3,8-9,14-15H2,(H,26,29)/t23-,24+/m1/s1
 QRVRSSCVKPCXKH-RPWUZVMVSA-N This stereoisomer Any stereoisomer
 O[C@@H]1Cc2c([C@@H]1NC(=O)c1cn(c3c1cccc3)CC1CCCCC1)cccc2