β-Caryophyllene
(1R,4E,9S)-4,11,11-Trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene
 8111 C15H24 204.351
 Cannabinoid
 InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m1/s1
 NPNUFJAVOOONJE-GFUGXAQUSA-N This stereoisomer Any stereoisomer
 C/C/1=C\CCC(=C)[C@@H]2[C@@H](CC1)C(C2)(C)C