8,11-Dihydroxy-Δ9-THC
(6aR,10aR)-9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl-6a,7,8,10a-tetrahydro-6H-dibenzo[b,d]pyran-1,8-diol
 8101 C21H30O4 346.461
 Cannabinoid
 InChI=1S/C21H30O4/c1-4-5-6-7-13-8-18(24)20-15-10-14(12-22)17(23)11-16(15)21(2,3)25-19(20)9-13/h8-10,15-17,22-24H,4-7,11-12H2,1-3H3/t15-,16-,17?/m1/s1
 XTDYIISRNODHHT-YNPPLXCJSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2C=C(CO)C(C1)O)(C)C