Cannabitriol
6,6,9-Trimethyl-3-pentyl-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1,9,10-triol
 8098 C21H30O4 346.461
 Cannabinoid
 InChI=1S/C21H30O4/c1-5-6-7-8-13-11-15(22)18-16(12-13)25-20(2,3)14-9-10-21(4,24)19(23)17(14)18/h11-12,19,22-24H,5-10H2,1-4H3
 ZLYNXDIDWUWASO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC(C1=C2C(O)C(CC1)(C)O)(C)C