6F-AB-HINACA
N-[(2S)-1-Amino-3-methyl-1-oxobutan-2-yl]-1-(6-fluorohexyl)-1H-indazole-3-carboxamide
 8070 C19H27FN4O2 362.442
 Cannabinoid
 InChI=1S/C19H27FN4O2/c1-13(2)16(18(21)25)22-19(26)17-14-9-5-6-10-15(14)24(23-17)12-8-4-3-7-11-20/h5-6,9-10,13,16H,3-4,7-8,11-12H2,1-2H3,(H2,21,25)(H,22,26)/t16-/m0/s1
 BKBQEPPCAFGQPP-INIZCTEOSA-N This stereoisomer Any stereoisomer
 FCCCCCCn1nc(c2c1cccc2)C(=O)N[C@H](C(=O)N)C(C)C