DMP-PICA
N-(2,6-Dimethylphenyl)-1-pentyl-1H-indole-3-carboxamide
 8067 C22H26N2O 334.455
 Cannabinoid
 InChI=1S/C22H26N2O/c1-4-5-8-14-24-15-19(18-12-6-7-13-20(18)24)22(25)23-21-16(2)10-9-11-17(21)3/h6-7,9-13,15H,4-5,8,14H2,1-3H3,(H,23,25)
 KBVGHJIKPHFUHG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1cc(c2c1cccc2)C(=O)Nc1c(C)cccc1C