2F-AB-PINACA
N-[(2S)-1-Amino-3-methyl-1-oxobutan-2-yl]-1-(2-fluoropentyl)-1H-indazole-3-carboxamide
 8054 C18H25FN4O2 348.415
 Cannabinoid
 InChI=1S/C18H25FN4O2/c1-4-7-12(19)10-23-14-9-6-5-8-13(14)16(22-23)18(25)21-15(11(2)3)17(20)24/h5-6,8-9,11-12,15H,4,7,10H2,1-3H3,(H2,20,24)(H,21,25)/t12?,15-/m0/s1
 VKIBZLGSWZHFJD-CVRLYYSRSA-N This stereoisomer Any stereoisomer
 CCCC(Cn1nc(c2c1cccc2)C(=O)N[C@H](C(=O)N)C(C)C)F