Desacetyl-levonantradol
(6S,6aR,9R,10aR)-6-Methyl-3-{[(2R)-5-phenylpentan-2-yl]oxy}-5,6,6a,7,8,9,10,10a-octahydrophenanthridine-1,9-diol
 8030 C25H33NO3 395.534
 Cannabinoid
 InChI=1S/C25H33NO3/c1-16(7-6-10-18-8-4-3-5-9-18)29-20-14-23-25(24(28)15-20)22-13-19(27)11-12-21(22)17(2)26-23/h3-5,8-9,14-17,19,21-22,26-28H,6-7,10-13H2,1-2H3/t16-,17+,19-,21+,22-/m1/s1
 YPYQDMBJZJZFQL-LLZYVPLJSA-N This stereoisomer Any stereoisomer
 O[C@@H]1CC[C@@H]2[C@@H](C1)c1c(O)cc(cc1N[C@H]2C)O[C@@H](CCCc1ccccc1)C