5Br-Δ8-THC
(6aR,10aR)-3-(5-Bromopentyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 8028 C21H29BrO2 393.358
 Cannabinoid
 InChI=1S/C21H29BrO2/c1-14-8-9-17-16(11-14)20-18(23)12-15(7-5-4-6-10-22)13-19(20)24-21(17,2)3/h8,12-13,16-17,23H,4-7,9-11H2,1-3H3/t16-,17-/m1/s1
 WUHQTFATTHTTJQ-IAGOWNOFSA-N This stereoisomer Any stereoisomer
 BrCCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2CC(=CC1)C)(C)C