2-Me-DPT
N-[2-(2-Methyl-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine
 7944  C17H26N2  258.402
 InChI=1S/C17H26N2/c1-4-11-19(12-5-2)13-10-15-14(3)18-17-9-7-6-8-16(15)17/h6-9,18H,4-5,10-13H2,1-3H3
 UAYMHVHOCKYWAW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c(C)[nH]c2c1cccc2)CCC