N,N-Me-DOMAI
4,7-Dimethoxy-N,N,5-trimethyl-2,3-dihydro-1H-inden-2-amine
 7870 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-9-6-13(16-4)11-7-10(15(2)3)8-12(11)14(9)17-5/h6,10H,7-8H2,1-5H3
 FTJSOXFWCAAEBF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(c2c1CC(C2)N(C)C)OC