3,6-Cl-2-MPEA
2-(3,6-Dichloro-2-methoxyphenyl)ethan-1-amine
 784  C9H11Cl2NO  220.096
 InChI=1S/C9H11Cl2NO/c1-13-9-6(4-5-12)7(10)2-3-8(9)11/h2-3H,4-5,12H2,1H3
 SDLDLOSTOYNNHN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Cl)ccc(c1OC)Cl