G-6
1-(5,8-Dimethoxy-1,2,3,4-tetrahydro-1,4-ethanonaphthalen-6-yl)propan-2-amine
 7832 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-10(18)8-13-9-14(19-2)15-11-4-6-12(7-5-11)16(15)17(13)20-3/h9-12H,4-8,18H2,1-3H3
 JFKYLEURGPBPTG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c2c1C1CCC2CC1)OC