ψ-ALEPH-2
1-[4-(Ethylsulfanyl)-2,6-dimethoxyphenyl]propan-2-amine
 7782 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-5-17-10-7-12(15-3)11(6-9(2)14)13(8-10)16-4/h7-9H,5-6,14H2,1-4H3
 UBJBIUDLAZEZPQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCSc1cc(OC)c(c(c1)OC)CC(N)C