DES-TMPEA-6
4-(2-Aminoethyl)-3,5-dimethoxyphenol
 7770 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-13-9-5-7(12)6-10(14-2)8(9)3-4-11/h5-6,12H,3-4,11H2,1-2H3
 FDWUZUJACGSKGQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(cc1OC)O