TMePEA-6
2-(2,4,6-Trimethylphenyl)ethan-1-amine
 7757 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7H,4-5,12H2,1-3H3
 QUIIKTQSGAWIAC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)cc(cc1C)C