6-Fluoro-1-pentyl-N-(2-phenylpropan-2-yl)-1H-indole-3-carboxamide
 7746  C23H27FN2O  366.472
 Cannabinoid
 InChI=1S/C23H27FN2O/c1-4-5-9-14-26-16-20(19-13-12-18(24)15-21(19)26)22(27)25-23(2,3)17-10-7-6-8-11-17/h6-8,10-13,15-16H,4-5,9,14H2,1-3H3,(H,25,27)
 MRPKLYXCJNFXJQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1cc(c2c1cc(F)cc2)C(=O)NC(c1ccccc1)(C)C