TMePEA-5
2-(2,3,6-Trimethylphenyl)ethan-1-amine
 7717 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-4-5-9(2)11(6-7-12)10(8)3/h4-5H,6-7,12H2,1-3H3
 NXEADSFJWMQHLC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)ccc(c1C)C