3,4,5-2C-T-7
2-[3,4-Dimethoxy-5-(propylsulfanyl)phenyl]ethan-1-amine
 7634 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-7-17-12-9-10(5-6-14)8-11(15-2)13(12)16-3/h8-9H,4-7,14H2,1-3H3
 WBCMIXLDMBKGBM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(CCN)cc(c1OC)OC