N-Pr-M
N-[2-(3,4,5-Trimethoxyphenyl)ethyl]propan-1-amine
 7630 C14H23NO3 253.337
 InChI=1S/C14H23NO3/c1-5-7-15-8-6-11-9-12(16-2)14(18-4)13(10-11)17-3/h9-10,15H,5-8H2,1-4H3
 KNGUSWJQDIVIQN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNCCc1cc(OC)c(c(c1)OC)OC