N-cPr-M
N-[2-(3,4,5-Trimethoxyphenyl)ethyl]cyclopropanamine
 7629 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-16-12-8-10(6-7-15-11-4-5-11)9-13(17-2)14(12)18-3/h8-9,11,15H,4-7H2,1-3H3
 CDEMNRGJMIWVIH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCNC2CC2)cc(c1OC)OC