AOM
1-(3,4,5-Trimethoxyphenyl)decan-2-amine
 7617  C19H33NO3  323.47
 InChI=1S/C19H33NO3/c1-5-6-7-8-9-10-11-16(20)12-15-13-17(21-2)19(23-4)18(14-15)22-3/h13-14,16H,5-12,20H2,1-4H3
 MCFRJYPZIDTASB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCCCC(Cc1cc(OC)c(c(c1)OC)OC)N