α-CMe-M
1-Chloro-3-(3,4,5-trimethoxyphenyl)propan-2-amine
 7605  C12H18ClNO3  259.729
 InChI=1S/C12H18ClNO3/c1-15-10-5-8(4-9(14)7-13)6-11(16-2)12(10)17-3/h5-6,9H,4,7,14H2,1-3H3
 JQXARIHJXXXTKR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClCC(Cc1cc(OC)c(c(c1)OC)OC)N