N-HO-TMA
N-Hydroxy-2-(3,4,5-trimethoxyphenyl)ethan-1-amine
 7601 C11H17NO4 227.257
 InChI=1S/C11H17NO4/c1-14-9-6-8(4-5-12-13)7-10(15-2)11(9)16-3/h6-7,12-13H,4-5H2,1-3H3
 ALKVNYLINLGCJH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONCCc1cc(OC)c(c(c1)OC)OC