4-HO-EIPT
3-{2-[Ethyl(propan-2-yl)amino]ethyl}-1H-indol-4-ol
 7586 C15H22N2O 246.348
 Prophetic?
 InChI=1S/C15H22N2O/c1-4-17(11(2)3)9-8-12-10-16-13-6-5-7-14(18)15(12)13/h5-7,10-11,16,18H,4,8-9H2,1-3H3
 ICODNLSOEJNDGB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(C)C)CCc1c[nH]c2c1c(O)ccc2