N-(MDA)-Fentanyl
N-{1-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]piperidin-4-yl}-N-phenylpropanamide
 7563 C24H30N2O3 394.507
 Fentanyl
 InChI=1S/C24H30N2O3/c1-3-24(27)26(20-7-5-4-6-8-20)21-11-13-25(14-12-21)18(2)15-19-9-10-22-23(16-19)29-17-28-22/h4-10,16,18,21H,3,11-15,17H2,1-2H3
 QUIXSQPQKKOKJC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(c1ccccc1)C1CCN(CC1)C(Cc1ccc2c(c1)OCO2)C