N-(2C-B)-Fentanyl
N-{1-[2-(4-Bromo-2,5-dimethoxyphenyl)ethyl]piperidin-4-yl}-N-phenylpropanamide
 7561 C24H31BrN2O3 475.419
 Fentanyl
 InChI=1S/C24H31BrN2O3/c1-4-24(28)27(19-8-6-5-7-9-19)20-11-14-26(15-12-20)13-10-18-16-23(30-3)21(25)17-22(18)29-2/h5-9,16-17,20H,4,10-15H2,1-3H3
 IWJDXHKRMXYRFD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(c1ccccc1)C1CCN(CC1)CCc1cc(OC)c(cc1OC)Br