4-HO-dmmor-T
3-[2-(3,5-Dimethylmorpholin-4-yl)ethyl]-1H-indol-4-ol
 7555  C16H22N2O2  274.358
 Prophetic?
 InChI=1S/C16H22N2O2/c1-11-9-20-10-12(2)18(11)7-6-13-8-17-14-4-3-5-15(19)16(13)14/h3-5,8,11-12,17,19H,6-7,9-10H2,1-2H3
 UQFVXABQETWGFD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1COCC(N1CCc1c[nH]c2c1c(O)ccc2)C