3,5-DESMETHYL
5-(2-Aminoethyl)-2-methoxybenzene-1,3-diol
 7554 C9H13NO3 183.204
 InChI=1S/C9H13NO3/c1-13-9-7(11)4-6(2-3-10)5-8(9)12/h4-5,11-12H,2-3,10H2,1H3
 GIHFHXFOWGWLMZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(c(c1)O)OC