THA
5-(2-Aminopropyl)benzene-1,2,3-triol
 7552  C9H13NO3  183.204
 InChI=1S/C9H13NO3/c1-5(10)2-6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,2,10H2,1H3
 GYQMECTUTWANKQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(O)c(c(c1)O)O)N