3,5-Br-DESMETHYL
4-(2-Aminoethyl)-2,6-dibromophenol
 7516  C8H9Br2NO  294.971
 InChI=1S/C8H9Br2NO/c9-6-3-5(1-2-11)4-7(10)8(6)12/h3-4,12H,1-2,11H2
 WRFLDHTYCUHHFK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(Br)c(c(c1)Br)O