5-Br-DESMETHYL
4-(2-Aminoethyl)-2-bromo-6-methoxyphenol
 7515  C9H12BrNO2  246.101
 InChI=1S/C9H12BrNO2/c1-13-8-5-6(2-3-11)4-7(10)9(8)12/h4-5,12H,2-3,11H2,1H3
 DFLMHXPBJMWDQX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)Br)O