3-Cl-4,5-DMA
1-(3-Chloro-4,5-dimethoxyphenyl)propan-2-amine
 7513  C11H16ClNO2  229.703
 InChI=1S/C11H16ClNO2/c1-7(13)4-8-5-9(12)11(15-3)10(6-8)14-2/h5-7H,4,13H2,1-3H3
 IRRVVRIRQPTTIX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1OC)Cl