3-Cl-4,5-DMPEA
2-(3-Chloro-4,5-dimethoxyphenyl)ethan-1-amine
 7512 C10H14ClNO2 215.677
 InChI=1S/C10H14ClNO2/c1-13-9-6-7(3-4-12)5-8(11)10(9)14-2/h5-6H,3-4,12H2,1-2H3
 YPCHSTYBWRNMKH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)Cl)OC