α-PCYP
2-Cyclohexyl-1-phenyl-2-(pyrrolidin-1-yl)ethan-1-one
 7495  C18H25NO  271.397
 InChI=1S/C18H25NO/c20-18(16-11-5-2-6-12-16)17(19-13-7-8-14-19)15-9-3-1-4-10-15/h2,5-6,11-12,15,17H,1,3-4,7-10,13-14H2
 FKEHRWJWTWDTDB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(C(N1CCCC1)C1CCCCC1)c1ccccc1