US4291059
(1R,2S)-2-(Methylamino)-1-phenylcyclopentyl propanoate
 7487 C15H21NO2 247.333
 InChI=1S/C15H21NO2/c1-3-14(17)18-15(11-7-10-13(15)16-2)12-8-5-4-6-9-12/h4-6,8-9,13,16H,3,7,10-11H2,1-2H3/t13-,15+/m0/s1
 DNHWMUHBZJIBFO-DZGCQCFKSA-N This stereoisomer Any stereoisomer
 CN[C@H]1CCC[C@@]1(OC(=O)CC)c1ccccc1