Butyl hexedrone
2-(Butylamino)-1-phenylhexan-1-one
 7450 C16H25NO 247.376
 InChI=1S/C16H25NO/c1-3-5-12-15(17-13-6-4-2)16(18)14-10-8-7-9-11-14/h7-11,15,17H,3-6,12-13H2,1-2H3
 UCYMCSGVJDYDIO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(C(=O)c1ccccc1)NCCCC