T-NBOH5Me
2-({[2-(1H-Indol-3-yl)ethyl]amino}methyl)-4-methylphenol
 7426  C18H20N2O  280.364
 InChI=1S/C18H20N2O/c1-13-6-7-18(21)15(10-13)11-19-9-8-14-12-20-17-5-3-2-4-16(14)17/h2-7,10,12,19-21H,8-9,11H2,1H3
 NUJVAIORJLFXKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(c(c1)CNCCc1c[nH]c2c1cccc2)O