T-NB4NO2
2-(1H-Indol-3-yl)-N-[(4-nitrophenyl)methyl]ethan-1-amine
 7418 C17H17N3O2 295.336
 InChI=1S/C17H17N3O2/c21-20(22)15-7-5-13(6-8-15)11-18-10-9-14-12-19-17-4-2-1-3-16(14)17/h1-8,12,18-19H,9-11H2
 IDNLCTISTSJTCZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=N(=O)c1ccc(cc1)CNCCc1c[nH]c2c1cccc2