T-NB4OEt
N-[(4-Ethoxyphenyl)methyl]-2-(1H-indol-3-yl)ethan-1-amine
 7412  C19H22N2O  294.391
 InChI=1S/C19H22N2O/c1-2-22-17-9-7-15(8-10-17)13-20-12-11-16-14-21-19-6-4-3-5-18(16)19/h3-10,14,20-21H,2,11-13H2,1H3
 LJZOLUCGMMXPBY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1)CNCCc1c[nH]c2c1cccc2