T-NB4OMe
2-(1H-Indol-3-yl)-N-[(4-methoxyphenyl)methyl]ethan-1-amine
 7410  C18H20N2O  280.364
 InChI=1S/C18H20N2O/c1-21-16-8-6-14(7-9-16)12-19-11-10-15-13-20-18-5-3-2-4-17(15)18/h2-9,13,19-20H,10-12H2,1H3
 MBINHSDRJFYMHA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CNCCc1c[nH]c2c1cccc2