4C-T-2
1-[4-(Ethylsulfanyl)-2,5-dimethoxyphenyl]butan-2-amine
 7371 C14H23NO2S 269.403
 InChI=1S/C14H23NO2S/c1-5-11(15)7-10-8-13(17-4)14(18-6-2)9-12(10)16-3/h8-9,11H,5-7,15H2,1-4H3
 KLAWPCIXPDTGCZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCSc1cc(OC)c(cc1OC)CC(CC)N