N-Me-ALEPH-2
1-[4-(Ethylsulfanyl)-2,5-dimethoxyphenyl]-N-methylpropan-2-amine
 7370 C14H23NO2S 269.403
 InChI=1S/C14H23NO2S/c1-6-18-14-9-12(16-4)11(7-10(2)15-3)8-13(14)17-5/h8-10,15H,6-7H2,1-5H3
 RXMRQMALCRZCOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCSc1cc(OC)c(cc1OC)CC(NC)C